![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ATTBI website/ | 2003-03-25 09:52 | - | |
| CEM-Discover_files/ | 2013-10-29 12:23 | - | |
| HW-chap6a-sol_files/ | 2013-10-23 23:53 | - | |
| HW-chap6a_files/ | 2013-10-23 23:53 | - | |
| HW/ | 2012-09-05 14:16 | - | |
| Production of a room temperature ionic liquid using a microwave reactor.fld/ | 2017-10-31 11:24 | - | |
| Top 100 Rx Drugs_files/ | 2011-09-09 11:21 | - | |
| __simmon_s/ | 2020-01-23 08:37 | - | |
| _vti_cnf/ | 2002-09-22 00:05 | - | |
| dol/ | 2003-01-15 12:33 | - | |
| golum-outreach-activities/ | 2018-04-14 18:41 | - | |
| golum/ | 2013-02-26 15:40 | - | |
| granz/ | 2005-09-06 11:38 | - | |
| nmr/ | 2018-03-04 12:01 | - | |
| salem/ | 2020-01-14 19:51 | - | |
| selective-oxidation_files/ | 2013-01-25 10:37 | - | |
| topo/ | 2005-03-07 19:08 | - | |
| star.gif | 2003-06-28 11:45 | 104 | |
| amy.html | 2002-08-27 05:33 | 232 | |
| chap16hw-fig2.gif | 2002-08-27 05:33 | 499 | |
| grignard_step1.gif | 2000-08-28 15:12 | 624 | |
| benzoin.gif | 2005-04-18 00:22 | 843 | |
| chap16hw-fig1.gif | 2002-08-27 05:33 | 1.1K | |
| dehydration.gif | 2001-07-31 22:17 | 1.2K | |
| taketwo.html | 2013-09-17 19:17 | 1.2K | |
| chemPracticeExams.html | 2004-01-20 12:14 | 1.2K | |
| grignard_step2.gif | 2000-08-28 15:12 | 1.3K | |
| acetanilide.gif | 2001-07-31 22:17 | 1.3K | |
| williamson-fig1.jpg | 2002-08-27 05:33 | 1.6K | |
| greenleader.html | 2006-02-03 10:38 | 1.6K | |
| _cloveworkup.html | 2000-10-17 10:00 | 1.9K | |
| chap16hw.html | 2002-08-27 05:33 | 2.1K | |
| _candle.html | 2010-09-06 20:54 | 2.1K | |
| _topolab.html | 2005-10-24 09:03 | 2.4K | |
| nitroaniline.gif | 2001-07-31 22:17 | 2.5K | |
| soap_figure1.gif | 2002-08-27 05:33 | 2.5K | |
| claisen.fig1.jpg | 2002-07-18 11:15 | 2.5K | |
| ald_ket_unk.html | 2000-08-28 15:12 | 2.7K | |
| ir-old.html | 2002-08-27 05:33 | 2.9K | |
| zubrick6.jpg | 2003-08-26 12:04 | 3.0K | |
| _williamson_old.html | 2002-08-27 05:33 | 3.0K | |
| photochemMech1.jpg | 2003-01-20 09:25 | 3.0K | |
| labSummary.html | 2003-02-21 13:16 | 3.2K | |
| diels1.jpg | 2002-08-27 05:33 | 3.4K | |
| williamson.html | 2003-06-28 12:20 | 3.4K | |
| solomons8.jpg | 2003-08-26 12:03 | 3.7K | |
| _distillation.html | 2010-09-27 13:26 | 4.1K | |
| _benzoin.html | 2005-04-18 00:24 | 4.2K | |
| diels2.jpg | 2002-08-27 05:33 | 4.2K | |
| zubrick.jpg | 2002-08-27 05:33 | 4.3K | |
| ir.html | 2001-07-31 22:17 | 4.3K | |
| zubrick_5th.jpg | 2002-08-27 05:33 | 4.5K | |
| labnotebook.html | 2001-07-31 22:17 | 4.6K | |
| limiting-reagent.html | 2001-07-31 22:16 | 4.6K | |
| _dielsalder.html | 2004-02-10 14:42 | 4.7K | |
| limiting-reagent.figures | 2000-08-28 15:12 | 4.8K | |
| hydrobenzoinReaction.JPG | 2004-01-25 16:54 | 4.9K | |
| dehydration.html | 2001-07-31 22:16 | 5.0K | |
| _mp-lab.html | 2007-09-10 07:39 | 5.1K | |
| Old-chemResources.html | 2004-02-12 13:35 | 5.1K | |
| solomons7th.jpg | 2002-08-27 05:33 | 5.4K | |
| solventlessAldol.jpg | 2003-09-29 22:54 | 5.4K | |
| solomons-guide.gif | 2000-08-28 15:12 | 5.5K | |
| _nitroaniline.html | 2001-07-31 22:17 | 5.5K | |
| cas.gif | 2002-08-27 05:33 | 5.6K | |
| photochemMech2.jpg | 2003-01-20 09:34 | 5.6K | |
| _hydrobenzoin.html | 2005-01-21 11:19 | 5.7K | |
| _claisenSchmidt.html | 2003-03-17 09:33 | 5.7K | |
| gc.html | 2002-09-27 18:30 | 5.7K | |
| gc.html copy | 2002-09-27 18:30 | 5.7K | |
| _photochem.html | 2004-01-20 13:37 | 5.7K | |
| gc-ssc.html | 2001-08-20 14:06 | 5.8K | |
| _acetanilide.html | 2002-09-17 11:21 | 5.9K | |
| photochemMech3.jpg | 2003-01-20 09:45 | 6.1K | |
| RSC.solutions.html | 2002-04-18 12:06 | 6.2K | |
| williamson-fig2.jpg | 2002-08-27 05:33 | 6.3K | |
| claisen.fig3.jpg | 2002-07-18 14:57 | 6.3K | |
| chemResources.html | 2011-08-23 20:43 | 6.7K | |
| photochemSummary.jpg | 2003-01-20 10:25 | 6.8K | |
| photochemMech4.jpg | 2003-01-20 09:50 | 6.8K | |
| GEMS-FAQ.html | 2006-02-15 22:50 | 7.1K | |
| _grignard.html | 2004-02-10 14:50 | 7.3K | |
| claisen.fig2.jpg | 2002-07-18 12:35 | 7.5K | |
| CHE213_SSII_2000_syl.html | 2002-08-27 05:33 | 9.2K | |
| unknown.html | 2005-02-28 11:14 | 9.5K | |
| solomons.gif | 2000-08-28 15:12 | 9.6K | |
| _solventlessAldol.html | 2003-10-01 12:28 | 9.6K | |
| CHE213_Spring_2001_syl.html | 2002-08-27 05:33 | 9.9K | |
| che211-summer2015.html | 2015-05-17 07:43 | 10K | |
| CHE212_SSI_2000_syl.html | 2002-08-27 05:33 | 10K | |
| che213.html | 2002-08-27 05:33 | 10K | |
| che211-summer2014.html | 2014-05-29 15:44 | 10K | |
| CHE213_SSII_2001_syl.html | 2002-08-27 05:33 | 10K | |
| CHE212_Fall_2000_syl.html | 2002-08-27 05:33 | 11K | |
| che212-summer2014-initial.html | 2014-06-23 16:59 | 11K | |
| che212-summer2014.html | 2014-06-23 17:03 | 11K | |
| index.html-old | 2002-08-27 05:33 | 11K | |
| CHE212_SSI_2001_syl.html | 2002-08-27 05:33 | 11K | |
| che211-summer2013-final.html | 2013-05-21 15:46 | 11K | |
| CH211_F_2000_syl.html | 2002-08-27 05:33 | 11K | |
| che211-summer2012.html | 2012-05-22 15:18 | 11K | |
| che211-summer2012-final.html | 2012-06-24 12:28 | 11K | |
| che211-summer2013.html | 2013-03-12 22:57 | 11K | |
| che211-summer2011.html | 2011-06-26 12:11 | 11K | |
| index1.html | 2003-06-22 19:54 | 12K | |
| che212-summer2013-final.html | 2013-06-24 17:36 | 12K | |
| che212-summer2013.html | 2013-06-24 17:34 | 12K | |
| CH211_F_2001_syl.html.OLD | 2002-08-27 05:33 | 12K | |
| CH211_F_2001_syl.html | 2002-08-27 05:33 | 12K | |
| CHE213-sum2005-final.html | 2005-05-22 22:12 | 12K | |
| che212-summer2012.html | 2012-06-24 12:27 | 12K | |
| che212-summer2012-final.html | 2012-06-25 17:52 | 12K | |
| che212-summer2011.html | 2011-06-26 12:53 | 12K | |
| che212-summer2014-final.html | 2014-07-07 20:44 | 12K | |
| jacs.jpg | 2002-08-27 05:33 | 12K | |
| che212-summer2011-final.html | 2011-07-03 11:28 | 12K | |
| literature.html | 2004-10-18 10:19 | 12K | |
| che111-summer2014-final.html | 2014-06-17 22:42 | 13K | |
| che211-summer2015-final.html | 2015-05-27 22:31 | 13K | |
| che212-summer2015-final.html | 2015-06-28 14:48 | 13K | |
| che212-summer2015.html | 2015-06-23 21:06 | 13K | |
| old-literature.html | 2002-11-08 14:54 | 13K | |
| che212-summer2016.html | 2016-03-04 12:27 | 14K | |
| soap.html | 2000-08-28 15:12 | 14K | |
| ch211_fall2003.html-old | 2003-08-26 12:11 | 15K | |
| ch211_fall2003.html | 2006-06-15 15:30 | 15K | |
| CH211_F_2002_syl.html.OLD | 2002-08-27 05:44 | 15K | |
| CH211_F_2002_syl.html | 2002-09-27 18:26 | 15K | |
| ch211fa2003.html | 2003-11-04 11:26 | 15K | |
| ch21104fa.html | 2004-10-01 09:36 | 16K | |
| ch211fa2006-final.html | 2006-08-30 00:59 | 16K | |
| ch211fa2006.html | 2006-08-30 00:54 | 16K | |
| che211-summer-2016-final.html | 2016-05-23 00:11 | 16K | |
| che211-summer2016.html | 2016-05-23 00:09 | 16K | |
| ch211fa2007-duplicate.html | 2007-08-27 21:06 | 16K | |
| ch211fa2007.html | 2009-09-07 21:21 | 16K | |
| chem211fa2008.html | 2008-08-26 21:43 | 16K | |
| ch211fa2005.html | 2005-08-21 20:26 | 16K | |
| zubrick9.jpg | 2013-08-28 00:14 | 16K | |
| chem211.html | 2008-08-26 21:51 | 16K | |
| che211-fall2008.html | 2008-10-07 18:28 | 17K | |
| chemrev.jpg | 2002-08-27 05:33 | 17K | |
| fw.html | 2010-02-05 14:14 | 18K | |
| acid base table.pdf | 2019-01-16 20:33 | 18K | |
| _biodiesel.html | 2007-06-11 14:30 | 18K | |
| CHE213_spring2005.html | 2006-03-21 21:44 | 18K | |
| solomons11.jpg | 2013-08-28 00:14 | 19K | |
| zubrick7.jpg | 2007-08-27 20:08 | 19K | |
| hydrobenzoinMechanism.JPG | 2004-01-25 21:11 | 19K | |
| joc.jpg | 2002-08-27 05:33 | 19K | |
| syllabus-0 | 2002-08-27 05:33 | 19K | |
| syllabus | 2000-08-28 15:12 | 19K | |
| CHE212-spring2010.html | 2010-01-13 10:38 | 20K | |
| che212-spring2014-initial.html | 2014-01-13 20:40 | 20K | |
| CHE212-spring2013-initial.html | 2013-01-15 23:31 | 20K | |
| CHE212-spring2013.html | 2013-01-15 23:34 | 20K | |
| che212-spring2013-final.html | 2013-04-05 11:43 | 20K | |
| LAB NOTEBOOK GUIDELINES.doc | 2002-08-27 05:33 | 21K | |
| CHE212-spring2012.html | 2012-01-20 12:23 | 21K | |
| che212-spring2012-final.html | 2012-03-05 22:23 | 21K | |
| distillation.xls | 2005-09-21 14:12 | 22K | |
| zubrick10.jpg | 2018-12-03 15:52 | 22K | |
| che212-spring2014-final.html | 2014-04-09 10:50 | 22K | |
| che212-spring2015-initial.html | 2015-01-13 16:59 | 22K | |
| che212-spring2015-initial-2.html | 2015-01-13 18:57 | 22K | |
| che212-spring2015.html | 2015-05-25 10:26 | 23K | |
| index-spring2015-final.html | 2015-04-01 13:33 | 23K | |
| CH212_S_2002_syl.html | 2002-08-27 05:33 | 23K | |
| ch212_s_2002_syl.html-new | 2002-08-27 05:33 | 23K | |
| solomons9.jpg | 2007-08-27 20:08 | 24K | |
| solomons12.jpg | 2018-12-03 15:51 | 25K | |
| che211-fall2011-initial.html | 2011-08-23 22:24 | 25K | |
| che211-fall2011-final.html | 2011-09-09 11:20 | 25K | |
| che211-fall2012-initial.html | 2012-08-28 17:29 | 25K | |
| index-spring2017-initial.html | 2017-01-20 09:10 | 25K | |
| HW-chap6a.htm | 2013-10-23 23:53 | 26K | |
| che211-fall2010-final.html | 2010-08-31 22:27 | 26K | |
| che211-fall2010.html | 2010-08-24 23:41 | 26K | |
| che211-fall2009.html | 2009-08-26 09:08 | 26K | |
| che211-fall2009-final.html | 2009-09-07 21:22 | 26K | |
| che212-spring2017-final.html | 2017-08-30 08:36 | 26K | |
| ch21203sp.html | 2004-01-13 14:38 | 26K | |
| ch21204sp.html | 2004-02-12 10:14 | 26K | |
| CH212_S_2003_syl.html | 2003-06-28 12:03 | 26K | |
| Reactions, reagents, mechanisms spreadsheet; chap 1-10.pdf | 2018-01-16 10:31 | 27K | |
| old_index.html | 2003-01-31 11:20 | 27K | |
| ch212sp2007-final.html | 2007-01-19 10:31 | 27K | |
| che211-fall2012-final.html | 2013-08-27 23:22 | 27K | |
| ch212sp2008.html | 2008-08-26 21:52 | 27K | |
| mechanism handout.pdf | 2019-01-17 16:42 | 28K | |
| che212-spring2009-orig.html | 2009-01-13 22:22 | 28K | |
| che212-spring2009.html | 2009-02-09 13:21 | 28K | |
| HW-chap6a-sol.htm | 2013-10-23 23:53 | 28K | |
| che211-fall2013-initial.html | 2013-08-27 23:21 | 29K | |
| index-spring2018-before-revision.html | 2018-04-10 12:11 | 29K | |
| _greenBromination.doc | 2005-11-02 12:37 | 30K | |
| index-spring2018-revised.html | 2018-04-10 12:24 | 30K | |
| che211-fall2014-final.html | 2014-11-12 13:08 | 31K | |
| che211-fall2015-final.html | 2015-12-08 12:35 | 31K | |
| che211-fall2013-final.html | 2013-10-30 21:37 | 31K | |
| index-che211-fall2013-final.html | 2014-08-27 10:59 | 31K | |
| che211-fall2017-initial-1.html | 2017-08-30 09:10 | 31K | |
| _tolan.doc | 2005-11-02 12:45 | 32K | |
| che211-fall2017-final.html | 2017-11-14 17:10 | 32K | |
| che212-spring2019-initial.html | 2018-12-02 22:20 | 32K | |
| che211-fall2016-initial.html | 2016-08-23 19:10 | 32K | |
| che211-fall2016-final.html | 2016-11-28 13:51 | 33K | |
| CH212-spring2019-final.html | 2019-04-17 13:04 | 33K | |
| _solventless-diels-alder.doc | 2008-09-04 10:30 | 37K | |
| Reactions Worksheet - Organic 2 review sheet.pdf | 2018-01-16 10:01 | 41K | |
| Organic_calculations-bad format.doc | 2006-09-12 12:17 | 43K | |
| calculcations.doc | 2008-05-18 23:48 | 43K | |
| _ecotoxicityHandout.doc | 2008-01-23 09:43 | 45K | |
| quickstart.xls | 2007-01-19 10:29 | 45K | |
| Organic_calculations.doc | 2007-09-11 15:31 | 48K | |
| _RTIL.html | 2017-10-31 14:47 | 48K | |
| CEM-Discover.html | 2013-10-29 12:32 | 51K | |
| _selective-oxidation.html | 2015-06-28 14:42 | 54K | |
| quickstart-2008.xls | 2008-01-25 09:41 | 59K | |
| solomons10.jpg | 2010-08-24 23:38 | 59K | |
| ch212-op2-2008.doc | 2008-04-04 09:36 | 64K | |
| zubrick8.jpg | 2010-08-24 23:38 | 64K | |
| quickstart-2012.xls | 2012-01-24 14:22 | 65K | |
| quickstart-2014.xls | 2014-01-14 22:20 | 65K | |
| CHAPTER 11B worksheet.pdf | 2019-01-24 22:23 | 67K | |
| Reactions, reagents, mechanisms spreadsheet; chap 1-10.xlsx | 2018-01-16 10:15 | 68K | |
| _benzoin.pdf | 2019-02-15 10:58 | 76K | |
| ch212-op2-nmr-2008.doc | 2008-04-04 09:36 | 77K | |
| The Game of Resonance.pdf | 2018-01-30 12:56 | 77K | |
| _Montmorillonite-alkene.pdf | 2011-08-23 22:25 | 80K | |
| Top 100 Rx Drugs.html | 2011-09-09 11:21 | 90K | |
| _Green microwave catalytic oxidation of benzoin to benzil.pdf | 2018-01-15 09:52 | 90K | |
| _Aqueous-Diels-Alder.pdf | 2010-02-05 17:41 | 93K | |
| _Diels-Alder.pdf | 2009-05-31 16:10 | 93K | |
| Selective Oxidation.pdf | 2012-02-10 10:54 | 93K | |
| CHAPTER 11A worksheet.pdf | 2019-01-23 09:52 | 100K | |
| OLD - Mechanochemical synthesis of coumarin.pdf | 2018-01-18 09:22 | 109K | |
| _Mechanochemical synthesis of coumarin.pdf | 2018-04-10 10:46 | 110K | |
| zubrick9.tif | 2013-08-28 00:13 | 135K | |
| solomons11.tif | 2013-08-28 00:13 | 157K | |
| calculations-new.pdf | 2014-05-21 15:11 | 176K | |
| predicting mechanisms lecture.pdf | 2019-01-17 17:12 | 218K | |
| TakehomeOp2-NMR.pdf | 2013-04-05 11:08 | 449K | |
| SciFinder Scholar lab.doc | 2017-10-06 20:00 | 509K | |
| chemsk.pdf | 2002-08-27 05:33 | 1.1M | |
| TakehomeOp2.pdf | 2013-04-05 11:08 | 1.5M | |
| ch42.pdf | 2007-03-05 11:01 | 2.4M | |
| Solomons - chapters 1 and 2.pdf | 2017-05-23 13:32 | 7.3M | |